About cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate
cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate (PubChem CID 143224619) has the molecular formula C17H28N2O2S2
and a molecular weight of 356.56 g/mol. Its IUPAC name is cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate.
Molecular Properties
| Compound Name | cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
| PubChem CID | 143224619 |
| Molecular Formula | C17H28N2O2S2 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
| SMILES | CC(C)(Sc1nc(CCN)cs1)C(=O)OC1CCCCCCC1 |
| InChI | InChI=1S/C17H28N2O2S2/c1-17(2,23-16-19-13(10-11-18)12-22-16)15(20)21-14-8-6-4-3-5-7-9-14/h12,14H,3-11,18H2,1-2H3 |
| InChIKey | XKKHTDHOUFEECC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate?
The IUPAC name of cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate (CID 143224619) is cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate.
What is the SMILES notation for cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate?
The canonical SMILES for cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate is CC(C)(Sc1nc(CCN)cs1)C(=O)OC1CCCCCCC1.
What is the InChIKey of cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate?
The InChIKey is XKKHTDHOUFEECC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O2S2/c1-17(2,23-16-19-13(10-11-18)12-22-16)15(20)21-14-8-6-4-3-5-7-9-14/h12,14H,3-11,18H2,1-2H3.
What are the key properties of cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate?
cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate has a molecular weight of 356.56 g/mol, XLogP of 4.17, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooctyl 2-[[4-(2-aminoethyl)-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate is sourced from PubChem (CID 143224619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).