C18H15N5O — CID 143225793
2-[[4-(1,5-dihydropyrrolo[2,3-b]azepin-3-yl)pyrimidin-2-yl]amino]phenol (PubChem CID 143225793) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[[4-(1,5-dihydropyrrolo[2,3-b]azepin-3-yl)pyrimidin-2-yl]amino]phenol.
| Compound Name | 2-[[4-(1,5-dihydropyrrolo[2,3-b]azepin-3-yl)pyrimidin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 143225793 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[[4-(1,5-dihydropyrrolo[2,3-b]azepin-3-yl)pyrimidin-2-yl]amino]phenol |
| SMILES | Oc1ccccc1Nc1nccc(-c2c[nH]c3c2=CCC=CN=3)n1 |
| InChI | InChI=1S/C18H15N5O/c24-16-7-2-1-6-15(16)23-18-20-10-8-14(22-18)13-11-21-17-12(13)5-3-4-9-19-17/h1-2,4-11,24H,3H2,(H,19,21)(H,20,22,23) |
| InChIKey | GXKXNIGXJXUXBU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|