C16H29N — CID 143226091
2-(3,4-dimethylpentyl)-N-methylaniline;ethane (PubChem CID 143226091) has the molecular formula C16H29N and a molecular weight of 235.42 g/mol. Its IUPAC name is 2-(3,4-dimethylpentyl)-N-methylaniline;ethane.
| Compound Name | 2-(3,4-dimethylpentyl)-N-methylaniline;ethane |
|---|---|
| PubChem CID | 143226091 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.42 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 2-(3,4-dimethylpentyl)-N-methylaniline;ethane |
| SMILES | CC.CNc1ccccc1CCC(C)C(C)C |
| InChI | InChI=1S/C14H23N.C2H6/c1-11(2)12(3)9-10-13-7-5-6-8-14(13)15-4;1-2/h5-8,11-12,15H,9-10H2,1-4H3;1-2H3 |
| InChIKey | HPXWUJDDVPZROB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |