About ethane;nitromethane;pyridine
ethane;nitromethane;pyridine (PubChem CID 143226496) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is ethane;nitromethane;pyridine.
Molecular Properties
| Compound Name | ethane;nitromethane;pyridine |
| PubChem CID | 143226496 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | ethane;nitromethane;pyridine |
| SMILES | CC.C[N+](=O)[O-].c1ccncc1 |
| InChI | InChI=1S/C5H5N.C2H6.CH3NO2/c1-2-4-6-5-3-1;1-2;1-2(3)4/h1-5H;1-2H3;1H3 |
| InChIKey | OMWXDIQJUYBISG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;nitromethane;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;nitromethane;pyridine?
The IUPAC name of ethane;nitromethane;pyridine (CID 143226496) is ethane;nitromethane;pyridine.
What is the SMILES notation for ethane;nitromethane;pyridine?
The canonical SMILES for ethane;nitromethane;pyridine is CC.C[N+](=O)[O-].c1ccncc1.
What is the InChIKey of ethane;nitromethane;pyridine?
The InChIKey is OMWXDIQJUYBISG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.C2H6.CH3NO2/c1-2-4-6-5-3-1;1-2;1-2(3)4/h1-5H;1-2H3;1H3.
What are the key properties of ethane;nitromethane;pyridine?
ethane;nitromethane;pyridine has a molecular weight of 170.21 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;nitromethane;pyridine is sourced from PubChem (CID 143226496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).