C12H22N2O2 — CID 143226619
(E)-2-[(Z)-2-(methoxyamino)ethenyl]-N-[(2S)-2-methylbutyl]but-2-enamide (PubChem CID 143226619) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (E)-2-[(Z)-2-(methoxyamino)ethenyl]-N-[(2S)-2-methylbutyl]but-2-enamide.
| Compound Name | (E)-2-[(Z)-2-(methoxyamino)ethenyl]-N-[(2S)-2-methylbutyl]but-2-enamide |
|---|---|
| PubChem CID | 143226619 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (E)-2-[(Z)-2-(methoxyamino)ethenyl]-N-[(2S)-2-methylbutyl]but-2-enamide |
| SMILES | C/C=C(\C=C/NOC)C(=O)NC[C@@H](C)CC |
| InChI | InChI=1S/C12H22N2O2/c1-5-10(3)9-13-12(15)11(6-2)7-8-14-16-4/h6-8,10,14H,5,9H2,1-4H3,(H,13,15)/b8-7-,11-6+/t10-/m0/s1 |
| InChIKey | FZIPLLZWIYKZDG-LLPKDFBWSA-N |
| XLogP | 1.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|