About 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine
1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine (PubChem CID 143227137) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine |
| PubChem CID | 143227137 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine |
| SMILES | C/C=C\COCN(C)C |
| InChI | InChI=1S/C7H15NO/c1-4-5-6-9-7-8(2)3/h4-5H,6-7H2,1-3H3/b5-4- |
| InChIKey | IDOYDAXRRFYBDF-PLNGDYQASA-N |
| XLogP | 1.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine?
The IUPAC name of 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine (CID 143227137) is 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine is C/C=C\COCN(C)C.
What is the InChIKey of 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine?
The InChIKey is IDOYDAXRRFYBDF-PLNGDYQASA-N. The full InChI is InChI=1S/C7H15NO/c1-4-5-6-9-7-8(2)3/h4-5H,6-7H2,1-3H3/b5-4-.
What are the key properties of 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine?
1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine has a molecular weight of 129.20 g/mol, XLogP of 1.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-but-2-enoxy]-N,N-dimethylmethanamine is sourced from PubChem (CID 143227137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).