C30H32N4O3 — CID 143227548
[3-[(E)-3-(2-hydroxyethylamino)prop-1-enoxy]-4-(1H-indol-5-yl)phenyl]-(2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone (PubChem CID 143227548) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is [3-[(E)-3-(2-hydroxyethylamino)prop-1-enoxy]-4-(1H-indol-5-yl)phenyl]-(2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone.
| Compound Name | [3-[(E)-3-(2-hydroxyethylamino)prop-1-enoxy]-4-(1H-indol-5-yl)phenyl]-(2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone |
|---|---|
| PubChem CID | 143227548 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | [3-[(E)-3-(2-hydroxyethylamino)prop-1-enoxy]-4-(1H-indol-5-yl)phenyl]-(2-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc(-c3ccc4[nH]ccc4c3)c(O/C=C/CNCCO)c2)c2ccccc2N1 |
| InChI | InChI=1S/C30H32N4O3/c1-21-12-16-34(28-6-3-2-5-27(28)33-21)30(36)24-7-9-25(22-8-10-26-23(19-22)11-14-32-26)29(20-24)37-18-4-13-31-15-17-35/h2-11,14,18-21,31-33,35H,12-13,15-17H2,1H3/b18-4+ |
| InChIKey | NXFDMUPDQAJTEJ-JJPRUIFNSA-N |
| XLogP | 5.16 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|