C16H16N2O2 — CID 143227745
(E)-3-[2-(1-ethenylcyclobutyl)-3H-benzimidazol-5-yl]prop-2-enoic acid (PubChem CID 143227745) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (E)-3-[2-(1-ethenylcyclobutyl)-3H-benzimidazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(1-ethenylcyclobutyl)-3H-benzimidazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 143227745 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (E)-3-[2-(1-ethenylcyclobutyl)-3H-benzimidazol-5-yl]prop-2-enoic acid |
| SMILES | C=CC1(c2nc3ccc(/C=C/C(=O)O)cc3[nH]2)CCC1 |
| InChI | InChI=1S/C16H16N2O2/c1-2-16(8-3-9-16)15-17-12-6-4-11(5-7-14(19)20)10-13(12)18-15/h2,4-7,10H,1,3,8-9H2,(H,17,18)(H,19,20)/b7-5+ |
| InChIKey | QJAIETSSQILGSF-FNORWQNLSA-N |
| XLogP | 3.27 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|