About 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+)
5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+) (PubChem CID 143227751) has the molecular formula C4H5N2ORbS
and a molecular weight of 214.63 g/mol. Its IUPAC name is 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+).
Molecular Properties
| Compound Name | 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+) |
| PubChem CID | 143227751 |
| Molecular Formula | C4H5N2ORbS |
| Molecular Weight | 214.63 g/mol |
| Exact Mass | 213.92 |
| IUPAC Name | 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+) |
| SMILES | CC1NC(=S)[N-]C1=O.[Rb+] |
| InChI | InChI=1S/C4H6N2OS.Rb/c1-2-3(7)6-4(8)5-2;/h2H,1H3,(H2,5,6,7,8);/q;+1/p-1 |
| InChIKey | ORRURQHFOXHVBL-UHFFFAOYSA-M |
| XLogP | -2.83 |
| TPSA | 43.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.63 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+)?
The IUPAC name of 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+) (CID 143227751) is 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+).
What is the SMILES notation for 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+)?
The canonical SMILES for 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+) is CC1NC(=S)[N-]C1=O.[Rb+].
What is the InChIKey of 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+)?
The InChIKey is ORRURQHFOXHVBL-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6N2OS.Rb/c1-2-3(7)6-4(8)5-2;/h2H,1H3,(H2,5,6,7,8);/q;+1/p-1.
What are the key properties of 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+)?
5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+) has a molecular weight of 214.63 g/mol, XLogP of -2.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-sulfanylideneimidazolidin-3-id-4-one;rubidium(1+) is sourced from PubChem (CID 143227751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).