C28H44O — CID 143227846
(3R,10R,13R,14R,17R)-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-3,4,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 143227846) has the molecular formula C28H44O and a molecular weight of 396.66 g/mol. Its IUPAC name is (3R,10R,13R,14R,17R)-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-3,4,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,10R,13R,14R,17R)-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-3,4,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 143227846 |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | (3R,10R,13R,14R,17R)-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-3,4,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=CC=C4C[C@@H](O)C=C[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C28H44O/c1-19(2)8-7-9-20(3)23-13-16-28(6)25-11-10-21-18-22(29)12-15-26(21,4)24(25)14-17-27(23,28)5/h10-12,15,19-20,22-24,29H,7-9,13-14,16-18H2,1-6H3/t20-,22+,23-,24?,26+,27-,28+/m1/s1 |
| InChIKey | NOHXZFQWCVDEEY-QJAQCREHSA-N |
| XLogP | 7.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|