About 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one
1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one (PubChem CID 143228067) has the molecular formula C13H16N2OS
and a molecular weight of 248.35 g/mol. Its IUPAC name is 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one.
Molecular Properties
| Compound Name | 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one |
| PubChem CID | 143228067 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one |
| SMILES | O=C1NCC2(CCN(S)CC2)c2ccccc21 |
| InChI | InChI=1S/C13H16N2OS/c16-12-10-3-1-2-4-11(10)13(9-14-12)5-7-15(17)8-6-13/h1-4,17H,5-9H2,(H,14,16) |
| InChIKey | OXCCTXXXNUYOGT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one?
The IUPAC name of 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one (CID 143228067) is 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one.
What is the SMILES notation for 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one?
The canonical SMILES for 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one is O=C1NCC2(CCN(S)CC2)c2ccccc21.
What is the InChIKey of 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one?
The InChIKey is OXCCTXXXNUYOGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS/c16-12-10-3-1-2-4-11(10)13(9-14-12)5-7-15(17)8-6-13/h1-4,17H,5-9H2,(H,14,16).
What are the key properties of 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one?
1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one has a molecular weight of 248.35 g/mol, XLogP of 1.61, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one is sourced from PubChem (CID 143228067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).