C13H16N2OS — CID 143228067
1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one (PubChem CID 143228067) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one.
| Compound Name | 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 143228067 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1'-sulfanylspiro[2,3-dihydroisoquinoline-4,4'-piperidine]-1-one |
| SMILES | O=C1NCC2(CCN(S)CC2)c2ccccc21 |
| InChI | InChI=1S/C13H16N2OS/c16-12-10-3-1-2-4-11(10)13(9-14-12)5-7-15(17)8-6-13/h1-4,17H,5-9H2,(H,14,16) |
| InChIKey | OXCCTXXXNUYOGT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|