About 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal
3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal (PubChem CID 14322950) has the molecular formula C16H32O2Si
and a molecular weight of 284.52 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal.
Molecular Properties
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal |
| PubChem CID | 14322950 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal |
| SMILES | CC(C)=CCCC(C)(CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O2Si/c1-14(2)10-9-11-16(6,12-13-17)18-19(7,8)15(3,4)5/h10,13H,9,11-12H2,1-8H3 |
| InChIKey | JRYXLMPHXVWVDH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal?
The IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal (CID 14322950) is 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal.
What is the SMILES notation for 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal?
The canonical SMILES for 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal is CC(C)=CCCC(C)(CC=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal?
The InChIKey is JRYXLMPHXVWVDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2Si/c1-14(2)10-9-11-16(6,12-13-17)18-19(7,8)15(3,4)5/h10,13H,9,11-12H2,1-8H3.
What are the key properties of 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal?
3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal has a molecular weight of 284.52 g/mol, XLogP of 5.10, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyloct-6-enal is sourced from PubChem (CID 14322950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).