About cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one
cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one (PubChem CID 14322960) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one.
Analyze cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one?
The IUPAC name of cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one (CID 14322960) is cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one.
What is the SMILES notation for cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one?
The canonical SMILES for cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one is C[C@H]1C[C@@H](O)CC(C)(C)C1=O.
What is the InChIKey of cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one?
The InChIKey is CSPVUHYZUZZRGF-NKWVEPMBSA-N. The full InChI is InChI=1S/C9H16O2/c1-6-4-7(10)5-9(2,3)8(6)11/h6-7,10H,4-5H2,1-3H3/t6-,7+/m0/s1.
What are the key properties of cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one?
cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one has a molecular weight of 156.22 g/mol, XLogP of 1.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(4R,6S)-4-hydroxy-2,2,6-trimethylcyclohexan-1-one is sourced from PubChem (CID 14322960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).