C20H21N5OS — CID 143229914
2-methyl-N-[(1S)-1-[3-(12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-4-yl)phenyl]ethyl]propanamide (PubChem CID 143229914) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-1-[3-(12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-4-yl)phenyl]ethyl]propanamide.
| Compound Name | 2-methyl-N-[(1S)-1-[3-(12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-4-yl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 143229914 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-methyl-N-[(1S)-1-[3-(12-methyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,10-pentaen-4-yl)phenyl]ethyl]propanamide |
| SMILES | CC(C)C(=O)N[C@@H](C)c1cccc(-c2nc3c(ncc4ncn(C)c43)s2)c1 |
| InChI | InChI=1S/C20H21N5OS/c1-11(2)18(26)23-12(3)13-6-5-7-14(8-13)19-24-16-17-15(22-10-25(17)4)9-21-20(16)27-19/h5-12H,1-4H3,(H,23,26)/t12-/m0/s1 |
| InChIKey | GIXQOQGJJSHWEA-LBPRGKRZSA-N |
| XLogP | 4.08 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |