C12H25N — CID 143229921
ethane;(E)-N,3,5,5-tetramethylhex-2-en-1-imine (PubChem CID 143229921) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is ethane;(E)-N,3,5,5-tetramethylhex-2-en-1-imine.
| Compound Name | ethane;(E)-N,3,5,5-tetramethylhex-2-en-1-imine |
|---|---|
| PubChem CID | 143229921 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | ethane;(E)-N,3,5,5-tetramethylhex-2-en-1-imine |
| SMILES | C/N=C/C=C(\C)CC(C)(C)C.CC |
| InChI | InChI=1S/C10H19N.C2H6/c1-9(6-7-11-5)8-10(2,3)4;1-2/h6-7H,8H2,1-5H3;1-2H3/b9-6+,11-7+; |
| InChIKey | OAKKXDZXUNDSNO-CZUIKUTNSA-N |
| XLogP | 4.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|