C11H21N5O4 — CID 143230399
2-amino-N-[2-[[1-(methylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl]pentanediamide (PubChem CID 143230399) has the molecular formula C11H21N5O4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-amino-N-[2-[[1-(methylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl]pentanediamide.
| Compound Name | 2-amino-N-[2-[[1-(methylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl]pentanediamide |
|---|---|
| PubChem CID | 143230399 |
| Molecular Formula | C11H21N5O4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-amino-N-[2-[[1-(methylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl]pentanediamide |
| SMILES | CNC(=O)C(C)NC(=O)CNC(=O)C(N)CCC(N)=O |
| InChI | InChI=1S/C11H21N5O4/c1-6(10(19)14-2)16-9(18)5-15-11(20)7(12)3-4-8(13)17/h6-7H,3-5,12H2,1-2H3,(H2,13,17)(H,14,19)(H,15,20)(H,16,18) |
| InChIKey | YCZXQQFACVAKHJ-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |