C28H37NO2 — CID 143231881
2-(cyclohexylmethyl)-5-ethyl-7-ethylidene-1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-4,5-dihydroquinoline-6,8-dione (PubChem CID 143231881) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-5-ethyl-7-ethylidene-1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-4,5-dihydroquinoline-6,8-dione.
| Compound Name | 2-(cyclohexylmethyl)-5-ethyl-7-ethylidene-1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-4,5-dihydroquinoline-6,8-dione |
|---|---|
| PubChem CID | 143231881 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 2-(cyclohexylmethyl)-5-ethyl-7-ethylidene-1-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-4,5-dihydroquinoline-6,8-dione |
| SMILES | C=C(/C=C\C=C/C)CN1C(CC2CCCCC2)=CCC2=C1C(=O)C(=CC)C(=O)C2CC |
| InChI | InChI=1S/C28H37NO2/c1-5-8-10-13-20(4)19-29-22(18-21-14-11-9-12-15-21)16-17-25-23(6-2)27(30)24(7-3)28(31)26(25)29/h5,7-8,10,13,16,21,23H,4,6,9,11-12,14-15,17-19H2,1-3H3/b8-5-,13-10-,24-7? |
| InChIKey | FSHCADPXVIOLLN-APZHPNSKSA-N |
| XLogP | 6.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|