C14H21N — CID 143231905
N-(2,4,6-trimethyl-3,5-dimethylidenecyclohexen-1-yl)propan-2-imine (PubChem CID 143231905) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-(2,4,6-trimethyl-3,5-dimethylidenecyclohexen-1-yl)propan-2-imine.
| Compound Name | N-(2,4,6-trimethyl-3,5-dimethylidenecyclohexen-1-yl)propan-2-imine |
|---|---|
| PubChem CID | 143231905 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-(2,4,6-trimethyl-3,5-dimethylidenecyclohexen-1-yl)propan-2-imine |
| SMILES | C=C1C(C)=C(N=C(C)C)C(C)C(=C)C1C |
| InChI | InChI=1S/C14H21N/c1-8(2)15-14-12(6)10(4)9(3)11(5)13(14)7/h9,12H,4-5H2,1-3,6-7H3 |
| InChIKey | MYEBIUNIPCMEHX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|