C24H43N3O — CID 143232012
(E)-3-[(C-butan-2-yl-N-cyclohexylcarbonimidoyl)amino]-N-ethyl-2-methyl-N-prop-1-en-2-ylhept-2-enamide (PubChem CID 143232012) has the molecular formula C24H43N3O and a molecular weight of 389.63 g/mol. Its IUPAC name is (E)-3-[(C-butan-2-yl-N-cyclohexylcarbonimidoyl)amino]-N-ethyl-2-methyl-N-prop-1-en-2-ylhept-2-enamide.
| Compound Name | (E)-3-[(C-butan-2-yl-N-cyclohexylcarbonimidoyl)amino]-N-ethyl-2-methyl-N-prop-1-en-2-ylhept-2-enamide |
|---|---|
| PubChem CID | 143232012 |
| Molecular Formula | C24H43N3O |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 389.34 |
| IUPAC Name | (E)-3-[(C-butan-2-yl-N-cyclohexylcarbonimidoyl)amino]-N-ethyl-2-methyl-N-prop-1-en-2-ylhept-2-enamide |
| SMILES | C=C(C)N(CC)C(=O)/C(C)=C(\CCCC)N/C(=N/C1CCCCC1)C(C)CC |
| InChI | InChI=1S/C24H43N3O/c1-8-11-17-22(20(7)24(28)27(10-3)18(4)5)26-23(19(6)9-2)25-21-15-13-12-14-16-21/h19,21H,4,8-17H2,1-3,5-7H3,(H,25,26)/b22-20+ |
| InChIKey | PADUCXOQJKKHDF-LSDHQDQOSA-N |
| XLogP | 6.20 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|