About ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene
ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene (PubChem CID 143232053) has the molecular formula C17H20
and a molecular weight of 224.35 g/mol. Its IUPAC name is ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene.
Molecular Properties
| Compound Name | ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene |
| PubChem CID | 143232053 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene |
| SMILES | C=C/C=C1\C(=C)C(=C)c2c(C)cccc21.CC |
| InChI | InChI=1S/C15H14.C2H6/c1-5-7-13-11(3)12(4)15-10(2)8-6-9-14(13)15;1-2/h5-9H,1,3-4H2,2H3;1-2H3/b13-7+; |
| InChIKey | UAHUTSPSTGXLAN-FTPOTTDRSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene?
The IUPAC name of ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene (CID 143232053) is ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene.
What is the SMILES notation for ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene?
The canonical SMILES for ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene is C=C/C=C1\C(=C)C(=C)c2c(C)cccc21.CC.
What is the InChIKey of ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene?
The InChIKey is UAHUTSPSTGXLAN-FTPOTTDRSA-N. The full InChI is InChI=1S/C15H14.C2H6/c1-5-7-13-11(3)12(4)15-10(2)8-6-9-14(13)15;1-2/h5-9H,1,3-4H2,2H3;1-2H3/b13-7+;.
What are the key properties of ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene?
ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene has a molecular weight of 224.35 g/mol, XLogP of 5.17, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1E)-4-methyl-2,3-dimethylidene-1-prop-2-enylideneindene is sourced from PubChem (CID 143232053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).