About 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran
4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran (PubChem CID 143232319) has the molecular formula C14H14O
and a molecular weight of 198.27 g/mol. Its IUPAC name is 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran.
Molecular Properties
| Compound Name | 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran |
| PubChem CID | 143232319 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran |
| SMILES | Cc1cccc2c1OC1=CC=CCCC12 |
| InChI | InChI=1S/C14H14O/c1-10-6-5-8-12-11-7-3-2-4-9-13(11)15-14(10)12/h2,4-6,8-9,11H,3,7H2,1H3 |
| InChIKey | CXQFHWNYWJWZDT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran?
The IUPAC name of 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran (CID 143232319) is 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran.
What is the SMILES notation for 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran?
The canonical SMILES for 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran is Cc1cccc2c1OC1=CC=CCCC12.
What is the InChIKey of 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran?
The InChIKey is CXQFHWNYWJWZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O/c1-10-6-5-8-12-11-7-3-2-4-9-13(11)15-14(10)12/h2,4-6,8-9,11H,3,7H2,1H3.
What are the key properties of 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran?
4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran has a molecular weight of 198.27 g/mol, XLogP of 3.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-10,10a-dihydro-9H-cyclohepta[b][1]benzofuran is sourced from PubChem (CID 143232319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).