C23H23N3O2S — CID 143232548
3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione;ethane (PubChem CID 143232548) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione;ethane.
| Compound Name | 3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione;ethane |
|---|---|
| PubChem CID | 143232548 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione;ethane |
| SMILES | CC.Oc1cc(O)c(C2CC2)cc1-c1n[nH]c(=S)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C21H17N3O2S.C2H6/c25-18-11-19(26)16(10-15(18)13-8-9-13)20-22-23-21(27)24(20)17-7-3-5-12-4-1-2-6-14(12)17;1-2/h1-7,10-11,13,25-26H,8-9H2,(H,23,27);1-2H3 |
| InChIKey | NTBRHAKRGFHEIR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|