C20H40N2O3 — CID 143232917
azepan-2-one;ethane;(E)-2-methoxy-8-methyldec-6-enamide (PubChem CID 143232917) has the molecular formula C20H40N2O3 and a molecular weight of 356.55 g/mol. Its IUPAC name is azepan-2-one;ethane;(E)-2-methoxy-8-methyldec-6-enamide.
| Compound Name | azepan-2-one;ethane;(E)-2-methoxy-8-methyldec-6-enamide |
|---|---|
| PubChem CID | 143232917 |
| Molecular Formula | C20H40N2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.30 |
| IUPAC Name | azepan-2-one;ethane;(E)-2-methoxy-8-methyldec-6-enamide |
| SMILES | CC.CCC(C)/C=C/CCCC(OC)C(N)=O.O=C1CCCCCN1 |
| InChI | InChI=1S/C12H23NO2.C6H11NO.C2H6/c1-4-10(2)8-6-5-7-9-11(15-3)12(13)14;8-6-4-2-1-3-5-7-6;1-2/h6,8,10-11H,4-5,7,9H2,1-3H3,(H2,13,14);1-5H2,(H,7,8);1-2H3/b8-6+;; |
| InChIKey | IXCVGXGDNITPKD-OVGXCEQFSA-N |
| XLogP | 3.96 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|