C30H53FN2O5 — CID 143232936
1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one;methanamine;[(E)-2-methoxy-8-methyl-1-oxodec-6-en-5-yl] acetate (PubChem CID 143232936) has the molecular formula C30H53FN2O5 and a molecular weight of 540.76 g/mol. Its IUPAC name is 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one;methanamine;[(E)-2-methoxy-8-methyl-1-oxodec-6-en-5-yl] acetate.
| Compound Name | 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one;methanamine;[(E)-2-methoxy-8-methyl-1-oxodec-6-en-5-yl] acetate |
|---|---|
| PubChem CID | 143232936 |
| Molecular Formula | C30H53FN2O5 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one;methanamine;[(E)-2-methoxy-8-methyl-1-oxodec-6-en-5-yl] acetate |
| SMILES | CC/C=C(\C/C=C\CF)CN1CCCCCC1=O.CCC(C)/C=C/C(CCC(C=O)OC)OC(C)=O.CN |
| InChI | InChI=1S/C15H24FNO.C14H24O4.CH5N/c1-2-8-14(9-5-6-11-16)13-17-12-7-3-4-10-15(17)18;1-5-11(2)6-7-13(18-12(3)16)8-9-14(10-15)17-4;1-2/h5-6,8H,2-4,7,9-13H2,1H3;6-7,10-11,13-14H,5,8-9H2,1-4H3;2H2,1H3/b6-5-,14-8+;7-6+; |
| InChIKey | SBRMIBKMNZJNNY-HYYLUIHVSA-N |
| XLogP | 5.73 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|