About 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one
1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one (PubChem CID 143232937) has the molecular formula C15H24FNO
and a molecular weight of 253.36 g/mol. Its IUPAC name is 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one.
Molecular Properties
| Compound Name | 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one |
| PubChem CID | 143232937 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one |
| SMILES | CC/C=C(\C/C=C\CF)CN1CCCCCC1=O |
| InChI | InChI=1S/C15H24FNO/c1-2-8-14(9-5-6-11-16)13-17-12-7-3-4-10-15(17)18/h5-6,8H,2-4,7,9-13H2,1H3/b6-5-,14-8+ |
| InChIKey | RGAVSBPCOHTUOE-PYLXQBKGSA-N |
| XLogP | 3.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one?
The IUPAC name of 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one (CID 143232937) is 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one.
What is the SMILES notation for 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one?
The canonical SMILES for 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one is CC/C=C(\C/C=C\CF)CN1CCCCCC1=O.
What is the InChIKey of 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one?
The InChIKey is RGAVSBPCOHTUOE-PYLXQBKGSA-N. The full InChI is InChI=1S/C15H24FNO/c1-2-8-14(9-5-6-11-16)13-17-12-7-3-4-10-15(17)18/h5-6,8H,2-4,7,9-13H2,1H3/b6-5-,14-8+.
What are the key properties of 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one?
1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one has a molecular weight of 253.36 g/mol, XLogP of 3.64, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z,2E)-6-fluoro-2-propylidenehex-4-enyl]azepan-2-one is sourced from PubChem (CID 143232937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).