C12H14N2O2 — CID 143233033
N-(2-methyl-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl)formamide (PubChem CID 143233033) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is N-(2-methyl-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl)formamide.
| Compound Name | N-(2-methyl-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl)formamide |
|---|---|
| PubChem CID | 143233033 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-(2-methyl-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl)formamide |
| SMILES | CN1Cc2ccccc2CC(NC=O)C1=O |
| InChI | InChI=1S/C12H14N2O2/c1-14-7-10-5-3-2-4-9(10)6-11(12(14)16)13-8-15/h2-5,8,11H,6-7H2,1H3,(H,13,15) |
| InChIKey | DBCQACOGORHGFZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|