C23H27ClN2O — CID 143233119
1-[4-(5-chloro-2-cyclobutylphenyl)-2-methylpiperazin-1-yl]-2-phenylethanone (PubChem CID 143233119) has the molecular formula C23H27ClN2O and a molecular weight of 382.94 g/mol. Its IUPAC name is 1-[4-(5-chloro-2-cyclobutylphenyl)-2-methylpiperazin-1-yl]-2-phenylethanone.
| Compound Name | 1-[4-(5-chloro-2-cyclobutylphenyl)-2-methylpiperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 143233119 |
| Molecular Formula | C23H27ClN2O |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-[4-(5-chloro-2-cyclobutylphenyl)-2-methylpiperazin-1-yl]-2-phenylethanone |
| SMILES | CC1CN(c2cc(Cl)ccc2C2CCC2)CCN1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H27ClN2O/c1-17-16-25(22-15-20(24)10-11-21(22)19-8-5-9-19)12-13-26(17)23(27)14-18-6-3-2-4-7-18/h2-4,6-7,10-11,15,17,19H,5,8-9,12-14,16H2,1H3 |
| InChIKey | LEJSABAXNCBDTD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |