C29H24F9N5 — CID 143233268
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-naphthalen-1-yl-5-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 143233268) has the molecular formula C29H24F9N5 and a molecular weight of 613.53 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-naphthalen-1-yl-5-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-naphthalen-1-yl-5-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 143233268 |
| Molecular Formula | C29H24F9N5 |
| Molecular Weight | 613.53 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-naphthalen-1-yl-5-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CN(N)/N=C(\N)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1cc(C(F)(F)F)ccc1-c1cccc2ccccc12 |
| InChI | InChI=1S/C29H24F9N5/c1-42(40)41-26(39)43(15-17-11-21(28(33,34)35)14-22(12-17)29(36,37)38)16-19-13-20(27(30,31)32)9-10-24(19)25-8-4-6-18-5-2-3-7-23(18)25/h2-14H,15-16,40H2,1H3,(H2,39,41) |
| InChIKey | WNHLUNQZCFRQLM-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.53 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|