C11H17NO2S — CID 143233892
4-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,4-thiazinane 1,1-dioxide (PubChem CID 143233892) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 4-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 143233892 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 4-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,4-thiazinane 1,1-dioxide |
| SMILES | C=C(C)/C=C\C(=C)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H17NO2S/c1-10(2)4-5-11(3)12-6-8-15(13,14)9-7-12/h4-5H,1,3,6-9H2,2H3/b5-4- |
| InChIKey | BJQHRFDHZBTUDM-PLNGDYQASA-N |
| XLogP | 1.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|