C25H28N4O3 — CID 143234189
3-[(2Z,3Z)-5-[(4-acetyl-3-hydroxy-2-methylphenoxy)methyl]-2-ethylidenehexa-3,5-dienyl]-N'-diazenylbenzenecarboximidamide (PubChem CID 143234189) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-[(2Z,3Z)-5-[(4-acetyl-3-hydroxy-2-methylphenoxy)methyl]-2-ethylidenehexa-3,5-dienyl]-N'-diazenylbenzenecarboximidamide.
| Compound Name | 3-[(2Z,3Z)-5-[(4-acetyl-3-hydroxy-2-methylphenoxy)methyl]-2-ethylidenehexa-3,5-dienyl]-N'-diazenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143234189 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-[(2Z,3Z)-5-[(4-acetyl-3-hydroxy-2-methylphenoxy)methyl]-2-ethylidenehexa-3,5-dienyl]-N'-diazenylbenzenecarboximidamide |
| SMILES | [H]/N=N/N=C(N)c1cccc(CC(/C=C\C(=C)COc2ccc(C(C)=O)c(O)c2C)=C/C)c1 |
| InChI | InChI=1S/C25H28N4O3/c1-5-19(13-20-7-6-8-21(14-20)25(26)28-29-27)10-9-16(2)15-32-23-12-11-22(18(4)30)24(31)17(23)3/h5-12,14,31H,2,13,15H2,1,3-4H3,(H3,26,27,28)/b10-9-,19-5+ |
| InChIKey | HITQNTRZHKZTHN-OMAZQPCRSA-N |
| XLogP | 5.23 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|