About methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal
methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal (PubChem CID 143234363) has the molecular formula C15H20O2S
and a molecular weight of 264.39 g/mol. Its IUPAC name is methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal.
Molecular Properties
| Compound Name | methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal |
| PubChem CID | 143234363 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal |
| SMILES | CO.CS/C(=C\C=C\c1ccccc1)CCC=O |
| InChI | InChI=1S/C14H16OS.CH4O/c1-16-14(11-6-12-15)10-5-9-13-7-3-2-4-8-13;1-2/h2-5,7-10,12H,6,11H2,1H3;2H,1H3/b9-5+,14-10-; |
| InChIKey | UKWKIBNQQYIFDZ-VQVLEILZSA-N |
| XLogP | 3.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal?
The IUPAC name of methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal (CID 143234363) is methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal.
What is the SMILES notation for methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal?
The canonical SMILES for methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal is CO.CS/C(=C\C=C\c1ccccc1)CCC=O.
What is the InChIKey of methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal?
The InChIKey is UKWKIBNQQYIFDZ-VQVLEILZSA-N. The full InChI is InChI=1S/C14H16OS.CH4O/c1-16-14(11-6-12-15)10-5-9-13-7-3-2-4-8-13;1-2/h2-5,7-10,12H,6,11H2,1H3;2H,1H3/b9-5+,14-10-;.
What are the key properties of methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal?
methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal has a molecular weight of 264.39 g/mol, XLogP of 3.53, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;(4Z,6E)-4-methylsulfanyl-7-phenylhepta-4,6-dienal is sourced from PubChem (CID 143234363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).