About ethane;methylcyclobutane;N-(4-methylphenyl)formamide
ethane;methylcyclobutane;N-(4-methylphenyl)formamide (PubChem CID 143234755) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is ethane;methylcyclobutane;N-(4-methylphenyl)formamide.
Molecular Properties
| Compound Name | ethane;methylcyclobutane;N-(4-methylphenyl)formamide |
| PubChem CID | 143234755 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | ethane;methylcyclobutane;N-(4-methylphenyl)formamide |
| SMILES | CC.CC1CCC1.Cc1ccc(NC=O)cc1 |
| InChI | InChI=1S/C8H9NO.C5H10.C2H6/c1-7-2-4-8(5-3-7)9-6-10;1-5-3-2-4-5;1-2/h2-6H,1H3,(H,9,10);5H,2-4H2,1H3;1-2H3 |
| InChIKey | JRYZMFWTRCYNAM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;methylcyclobutane;N-(4-methylphenyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methylcyclobutane;N-(4-methylphenyl)formamide?
The IUPAC name of ethane;methylcyclobutane;N-(4-methylphenyl)formamide (CID 143234755) is ethane;methylcyclobutane;N-(4-methylphenyl)formamide.
What is the SMILES notation for ethane;methylcyclobutane;N-(4-methylphenyl)formamide?
The canonical SMILES for ethane;methylcyclobutane;N-(4-methylphenyl)formamide is CC.CC1CCC1.Cc1ccc(NC=O)cc1.
What is the InChIKey of ethane;methylcyclobutane;N-(4-methylphenyl)formamide?
The InChIKey is JRYZMFWTRCYNAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C5H10.C2H6/c1-7-2-4-8(5-3-7)9-6-10;1-5-3-2-4-5;1-2/h2-6H,1H3,(H,9,10);5H,2-4H2,1H3;1-2H3.
What are the key properties of ethane;methylcyclobutane;N-(4-methylphenyl)formamide?
ethane;methylcyclobutane;N-(4-methylphenyl)formamide has a molecular weight of 235.37 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methylcyclobutane;N-(4-methylphenyl)formamide is sourced from PubChem (CID 143234755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).