About 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea
1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea (PubChem CID 14323483) has the molecular formula C9H20N2O7
and a molecular weight of 268.27 g/mol. Its IUPAC name is 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea.
Molecular Properties
| Compound Name | 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea |
| PubChem CID | 14323483 |
| Molecular Formula | C9H20N2O7 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea |
| SMILES | COC(OC)C(O)NC(=O)NC(O)C(OC)OC |
| InChI | InChI=1S/C9H20N2O7/c1-15-7(16-2)5(12)10-9(14)11-6(13)8(17-3)18-4/h5-8,12-13H,1-4H3,(H2,10,11,14) |
| InChIKey | MYGNTYVJTDYOAN-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea?
The IUPAC name of 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea (CID 14323483) is 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea.
What is the SMILES notation for 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea?
The canonical SMILES for 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea is COC(OC)C(O)NC(=O)NC(O)C(OC)OC.
What is the InChIKey of 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea?
The InChIKey is MYGNTYVJTDYOAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O7/c1-15-7(16-2)5(12)10-9(14)11-6(13)8(17-3)18-4/h5-8,12-13H,1-4H3,(H2,10,11,14).
What are the key properties of 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea?
1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea has a molecular weight of 268.27 g/mol, XLogP of -1.84, 8 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(1-hydroxy-2,2-dimethoxyethyl)urea is sourced from PubChem (CID 14323483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).