About N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline
N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline (PubChem CID 143234929) has the molecular formula C24H19N5
and a molecular weight of 377.45 g/mol. Its IUPAC name is N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline.
Molecular Properties
| Compound Name | N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline |
| PubChem CID | 143234929 |
| Molecular Formula | C24H19N5 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline |
| SMILES | c1ccc(CNc2cccc(-c3c[nH]c4ncc(-c5ccccn5)nc34)c2)cc1 |
| InChI | InChI=1S/C24H19N5/c1-2-7-17(8-3-1)14-26-19-10-6-9-18(13-19)20-15-27-24-23(20)29-22(16-28-24)21-11-4-5-12-25-21/h1-13,15-16,26H,14H2,(H,27,28) |
| InChIKey | ZYFIRGSBXXFWHN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline?
The IUPAC name of N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline (CID 143234929) is N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline.
What is the SMILES notation for N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline?
The canonical SMILES for N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline is c1ccc(CNc2cccc(-c3c[nH]c4ncc(-c5ccccn5)nc34)c2)cc1.
What is the InChIKey of N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline?
The InChIKey is ZYFIRGSBXXFWHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N5/c1-2-7-17(8-3-1)14-26-19-10-6-9-18(13-19)20-15-27-24-23(20)29-22(16-28-24)21-11-4-5-12-25-21/h1-13,15-16,26H,14H2,(H,27,28).
What are the key properties of N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline?
N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline has a molecular weight of 377.45 g/mol, XLogP of 5.30, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-(2-pyridin-2-yl-5H-pyrrolo[2,3-b]pyrazin-7-yl)aniline is sourced from PubChem (CID 143234929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).