About (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one
(6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one (PubChem CID 143234997) has the molecular formula C19H31NO2
and a molecular weight of 305.46 g/mol. Its IUPAC name is (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one.
Molecular Properties
| Compound Name | (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one |
| PubChem CID | 143234997 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one |
| SMILES | CC[C@H](C)CN1C(=O)CCC[C@@H]1CCC(O)CC1=CC=CC1 |
| InChI | InChI=1S/C19H31NO2/c1-3-15(2)14-20-17(9-6-10-19(20)22)11-12-18(21)13-16-7-4-5-8-16/h4-5,7,15,17-18,21H,3,6,8-14H2,1-2H3/t15-,17+,18?/m0/s1 |
| InChIKey | IYFCCHOVXBCXIE-CTDRKSARSA-N |
| XLogP | 3.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one?
The IUPAC name of (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one (CID 143234997) is (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one.
What is the SMILES notation for (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one?
The canonical SMILES for (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one is CC[C@H](C)CN1C(=O)CCC[C@@H]1CCC(O)CC1=CC=CC1.
What is the InChIKey of (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one?
The InChIKey is IYFCCHOVXBCXIE-CTDRKSARSA-N. The full InChI is InChI=1S/C19H31NO2/c1-3-15(2)14-20-17(9-6-10-19(20)22)11-12-18(21)13-16-7-4-5-8-16/h4-5,7,15,17-18,21H,3,6,8-14H2,1-2H3/t15-,17+,18?/m0/s1.
What are the key properties of (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one?
(6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one has a molecular weight of 305.46 g/mol, XLogP of 3.83, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-(4-cyclopenta-1,3-dien-1-yl-3-hydroxybutyl)-1-[(2S)-2-methylbutyl]piperidin-2-one is sourced from PubChem (CID 143234997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).