About 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene
5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene (PubChem CID 143235159) has the molecular formula C9H11FO2
and a molecular weight of 170.18 g/mol. Its IUPAC name is 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene |
| PubChem CID | 143235159 |
| Molecular Formula | C9H11FO2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene |
| SMILES | COC1=CC=C(OC)C(F)=CC1 |
| InChI | InChI=1S/C9H11FO2/c1-11-7-3-5-8(10)9(12-2)6-4-7/h4-6H,3H2,1-2H3 |
| InChIKey | XMZZYGBLARBJMG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene?
The IUPAC name of 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene (CID 143235159) is 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene.
What is the SMILES notation for 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene?
The canonical SMILES for 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene is COC1=CC=C(OC)C(F)=CC1.
What is the InChIKey of 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene?
The InChIKey is XMZZYGBLARBJMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO2/c1-11-7-3-5-8(10)9(12-2)6-4-7/h4-6H,3H2,1-2H3.
What are the key properties of 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene?
5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene has a molecular weight of 170.18 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,4-dimethoxycyclohepta-1,3,5-triene is sourced from PubChem (CID 143235159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).