C21H21ClN6O3S — CID 143235526
methyl N-[4-[[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-methyl-1,3-thiazole-5-carbonyl]amino]phenyl]-N-ethylcarbamimidate (PubChem CID 143235526) has the molecular formula C21H21ClN6O3S and a molecular weight of 472.96 g/mol. Its IUPAC name is methyl N-[4-[[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-methyl-1,3-thiazole-5-carbonyl]amino]phenyl]-N-ethylcarbamimidate.
| Compound Name | methyl N-[4-[[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-methyl-1,3-thiazole-5-carbonyl]amino]phenyl]-N-ethylcarbamimidate |
|---|---|
| PubChem CID | 143235526 |
| Molecular Formula | C21H21ClN6O3S |
| Molecular Weight | 472.96 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | methyl N-[4-[[4-[(5-chloro-2-pyridinyl)carbamoyl]-2-methyl-1,3-thiazole-5-carbonyl]amino]phenyl]-N-ethylcarbamimidate |
| SMILES | [H]/N=C(\OC)N(CC)c1ccc(NC(=O)c2sc(C)nc2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C21H21ClN6O3S/c1-4-28(21(23)31-3)15-8-6-14(7-9-15)26-20(30)18-17(25-12(2)32-18)19(29)27-16-10-5-13(22)11-24-16/h5-11,23H,4H2,1-3H3,(H,26,30)(H,24,27,29)/b23-21- |
| InChIKey | WYCPDRDILANWDJ-LNVKXUELSA-N |
| XLogP | 4.41 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|