C32H46F3N3O2 — CID 143235714
1-(6-propan-2-yloxy-3,4-dihydro-1H-isoquinolin-2-yl)-7-[4-[(1E,4E)-4-(trifluoromethyl)cycloocta-1,4-dien-1-yl]piperazin-1-yl]heptan-1-one (PubChem CID 143235714) has the molecular formula C32H46F3N3O2 and a molecular weight of 561.73 g/mol. Its IUPAC name is 1-(6-propan-2-yloxy-3,4-dihydro-1H-isoquinolin-2-yl)-7-[4-[(1E,4E)-4-(trifluoromethyl)cycloocta-1,4-dien-1-yl]piperazin-1-yl]heptan-1-one.
| Compound Name | 1-(6-propan-2-yloxy-3,4-dihydro-1H-isoquinolin-2-yl)-7-[4-[(1E,4E)-4-(trifluoromethyl)cycloocta-1,4-dien-1-yl]piperazin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 143235714 |
| Molecular Formula | C32H46F3N3O2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.35 |
| IUPAC Name | 1-(6-propan-2-yloxy-3,4-dihydro-1H-isoquinolin-2-yl)-7-[4-[(1E,4E)-4-(trifluoromethyl)cycloocta-1,4-dien-1-yl]piperazin-1-yl]heptan-1-one |
| SMILES | CC(C)Oc1ccc2c(c1)CCN(C(=O)CCCCCCN1CCN(/C3=C/C/C(C(F)(F)F)=C\CCC3)CC1)C2 |
| InChI | InChI=1S/C32H46F3N3O2/c1-25(2)40-30-15-12-27-24-38(18-16-26(27)23-30)31(39)11-5-3-4-8-17-36-19-21-37(22-20-36)29-10-7-6-9-28(13-14-29)32(33,34)35/h9,12,14-15,23,25H,3-8,10-11,13,16-22,24H2,1-2H3/b28-9+,29-14+ |
| InChIKey | DSDRMAQKGRCLOR-ORXMXDGISA-N |
| XLogP | 6.87 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|