C11H14F3NO — CID 143235788
2,3-dimethyl-6-(trifluoromethyl)pyridine;propan-2-one (PubChem CID 143235788) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 2,3-dimethyl-6-(trifluoromethyl)pyridine;propan-2-one.
| Compound Name | 2,3-dimethyl-6-(trifluoromethyl)pyridine;propan-2-one |
|---|---|
| PubChem CID | 143235788 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2,3-dimethyl-6-(trifluoromethyl)pyridine;propan-2-one |
| SMILES | CC(C)=O.Cc1ccc(C(F)(F)F)nc1C |
| InChI | InChI=1S/C8H8F3N.C3H6O/c1-5-3-4-7(8(9,10)11)12-6(5)2;1-3(2)4/h3-4H,1-2H3;1-2H3 |
| InChIKey | KKKSLAQUQZRFFN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |