About ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate
ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate (PubChem CID 143235793) has the molecular formula C11H14F3NO2
and a molecular weight of 249.23 g/mol. Its IUPAC name is ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate.
Molecular Properties
| Compound Name | ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate |
| PubChem CID | 143235793 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate |
| SMILES | C=C(C(=O)OCC)/C(C)=N/C(=C\C)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO2/c1-5-9(11(12,13)14)15-8(4)7(3)10(16)17-6-2/h5H,3,6H2,1-2,4H3/b9-5-,15-8+ |
| InChIKey | RQPSLYLUEIYZIX-NABZBBDKSA-N |
| XLogP | 3.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate?
The IUPAC name of ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate (CID 143235793) is ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate.
What is the SMILES notation for ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate?
The canonical SMILES for ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate is C=C(C(=O)OCC)/C(C)=N/C(=C\C)C(F)(F)F.
What is the InChIKey of ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate?
The InChIKey is RQPSLYLUEIYZIX-NABZBBDKSA-N. The full InChI is InChI=1S/C11H14F3NO2/c1-5-9(11(12,13)14)15-8(4)7(3)10(16)17-6-2/h5H,3,6H2,1-2,4H3/b9-5-,15-8+.
What are the key properties of ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate?
ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate has a molecular weight of 249.23 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylidene-3-[(Z)-1,1,1-trifluorobut-2-en-2-yl]iminobutanoate is sourced from PubChem (CID 143235793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).