C10H12N2O — CID 143236149
2-cyclohepta-1,6-dien-1-yl-5-methyl-1,3,4-oxadiazole (PubChem CID 143236149) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-cyclohepta-1,6-dien-1-yl-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-cyclohepta-1,6-dien-1-yl-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143236149 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-cyclohepta-1,6-dien-1-yl-5-methyl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(C2=CCCCC=C2)o1 |
| InChI | InChI=1S/C10H12N2O/c1-8-11-12-10(13-8)9-6-4-2-3-5-7-9/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | UMUKJQJJGPGLBK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |