C19H34FNO2S — CID 143236249
1-[(2E,3Z)-2-ethylidene-5-fluoro-1-methoxyhexa-3,5-dienyl]-N-propylcyclohexan-1-amine;hydroxysulfanylmethane (PubChem CID 143236249) has the molecular formula C19H34FNO2S and a molecular weight of 359.55 g/mol. Its IUPAC name is 1-[(2E,3Z)-2-ethylidene-5-fluoro-1-methoxyhexa-3,5-dienyl]-N-propylcyclohexan-1-amine;hydroxysulfanylmethane.
| Compound Name | 1-[(2E,3Z)-2-ethylidene-5-fluoro-1-methoxyhexa-3,5-dienyl]-N-propylcyclohexan-1-amine;hydroxysulfanylmethane |
|---|---|
| PubChem CID | 143236249 |
| Molecular Formula | C19H34FNO2S |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 1-[(2E,3Z)-2-ethylidene-5-fluoro-1-methoxyhexa-3,5-dienyl]-N-propylcyclohexan-1-amine;hydroxysulfanylmethane |
| SMILES | C=C(F)/C=C\C(=C/C)C(OC)C1(NCCC)CCCCC1.CSO |
| InChI | InChI=1S/C18H30FNO.CH4OS/c1-5-14-20-18(12-8-7-9-13-18)17(21-4)16(6-2)11-10-15(3)19;1-3-2/h6,10-11,17,20H,3,5,7-9,12-14H2,1-2,4H3;2H,1H3/b11-10-,16-6-; |
| InChIKey | MKFDGGGIQDXRGP-ZFKLODENSA-N |
| XLogP | 5.51 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|