C12H26FNO3S — CID 143236361
3-amino-3-cyclohexyl-2-fluoro-2-methylpropane-1-sulfonic acid;ethane (PubChem CID 143236361) has the molecular formula C12H26FNO3S and a molecular weight of 283.41 g/mol. Its IUPAC name is 3-amino-3-cyclohexyl-2-fluoro-2-methylpropane-1-sulfonic acid;ethane.
| Compound Name | 3-amino-3-cyclohexyl-2-fluoro-2-methylpropane-1-sulfonic acid;ethane |
|---|---|
| PubChem CID | 143236361 |
| Molecular Formula | C12H26FNO3S |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 3-amino-3-cyclohexyl-2-fluoro-2-methylpropane-1-sulfonic acid;ethane |
| SMILES | CC.CC(F)(CS(=O)(=O)O)C(N)C1CCCCC1 |
| InChI | InChI=1S/C10H20FNO3S.C2H6/c1-10(11,7-16(13,14)15)9(12)8-5-3-2-4-6-8;1-2/h8-9H,2-7,12H2,1H3,(H,13,14,15);1-2H3 |
| InChIKey | DXJTYIQZKJGSTC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|