C57H65N7 — CID 143236492
3-N,6-N,6-N-tris[4-(diethylamino)phenyl]-3-N-[4-[ethyl(methyl)amino]phenyl]-9-phenylcarbazole-3,6-diamine (PubChem CID 143236492) has the molecular formula C57H65N7 and a molecular weight of 848.20 g/mol. Its IUPAC name is 3-N,6-N,6-N-tris[4-(diethylamino)phenyl]-3-N-[4-[ethyl(methyl)amino]phenyl]-9-phenylcarbazole-3,6-diamine.
| Compound Name | 3-N,6-N,6-N-tris[4-(diethylamino)phenyl]-3-N-[4-[ethyl(methyl)amino]phenyl]-9-phenylcarbazole-3,6-diamine |
|---|---|
| PubChem CID | 143236492 |
| Molecular Formula | C57H65N7 |
| Molecular Weight | 848.20 g/mol |
| Exact Mass | 847.53 |
| IUPAC Name | 3-N,6-N,6-N-tris[4-(diethylamino)phenyl]-3-N-[4-[ethyl(methyl)amino]phenyl]-9-phenylcarbazole-3,6-diamine |
| SMILES | CCN(C)c1ccc(N(c2ccc(N(CC)CC)cc2)c2ccc3c(c2)c2cc(N(c4ccc(N(CC)CC)cc4)c4ccc(N(CC)CC)cc4)ccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C57H65N7/c1-9-58(8)43-21-29-48(30-22-43)62(49-31-23-44(24-32-49)59(10-2)11-3)52-37-39-56-54(41-52)55-42-53(38-40-57(55)64(56)47-19-17-16-18-20-47)63(50-33-25-45(26-34-50)60(12-4)13-5)51-35-27-46(28-36-51)61(14-6)15-7/h16-42H,9-15H2,1-8H3 |
| InChIKey | BPVIMKHXYOYAIS-UHFFFAOYSA-N |
| XLogP | 14.72 |
| TPSA | 24.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.20 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|