C23H32N2O2 — CID 143236897
(2S)-N-[(5-cyclopropyl-2-methoxy-3-pyridinyl)methyl]-2-(4-methylphenyl)butanamide;ethane (PubChem CID 143236897) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is (2S)-N-[(5-cyclopropyl-2-methoxy-3-pyridinyl)methyl]-2-(4-methylphenyl)butanamide;ethane.
| Compound Name | (2S)-N-[(5-cyclopropyl-2-methoxy-3-pyridinyl)methyl]-2-(4-methylphenyl)butanamide;ethane |
|---|---|
| PubChem CID | 143236897 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | (2S)-N-[(5-cyclopropyl-2-methoxy-3-pyridinyl)methyl]-2-(4-methylphenyl)butanamide;ethane |
| SMILES | CC.CC[C@H](C(=O)NCc1cc(C2CC2)cnc1OC)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H26N2O2.C2H6/c1-4-19(16-7-5-14(2)6-8-16)20(24)22-13-18-11-17(15-9-10-15)12-23-21(18)25-3;1-2/h5-8,11-12,15,19H,4,9-10,13H2,1-3H3,(H,22,24);1-2H3/t19-;/m0./s1 |
| InChIKey | NFNUQKCFRXEZCT-FYZYNONXSA-N |
| XLogP | 5.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |