C15H19NO2 — CID 143237230
5-[[(Z)-hex-4-enylidene]amino]-4-methylcyclohepta-1,3,5-triene-1-carboxylic acid (PubChem CID 143237230) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 5-[[(Z)-hex-4-enylidene]amino]-4-methylcyclohepta-1,3,5-triene-1-carboxylic acid.
| Compound Name | 5-[[(Z)-hex-4-enylidene]amino]-4-methylcyclohepta-1,3,5-triene-1-carboxylic acid |
|---|---|
| PubChem CID | 143237230 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 5-[[(Z)-hex-4-enylidene]amino]-4-methylcyclohepta-1,3,5-triene-1-carboxylic acid |
| SMILES | C/C=C\CC/C=N/C1=CCC(C(=O)O)=CC=C1C |
| InChI | InChI=1S/C15H19NO2/c1-3-4-5-6-11-16-14-10-9-13(15(17)18)8-7-12(14)2/h3-4,7-8,10-11H,5-6,9H2,1-2H3,(H,17,18)/b4-3-,16-11+ |
| InChIKey | QCFNWOWCQVHYOI-UECDWNJHSA-N |
| XLogP | 3.66 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|