C28H36N8 — CID 143237297
3-[2-(6-butan-2-yl-2-imidazol-1-ylpyrimidin-4-yl)piperidin-1-yl]-N-(quinoxalin-6-ylmethyl)propan-1-amine (PubChem CID 143237297) has the molecular formula C28H36N8 and a molecular weight of 484.65 g/mol. Its IUPAC name is 3-[2-(6-butan-2-yl-2-imidazol-1-ylpyrimidin-4-yl)piperidin-1-yl]-N-(quinoxalin-6-ylmethyl)propan-1-amine.
| Compound Name | 3-[2-(6-butan-2-yl-2-imidazol-1-ylpyrimidin-4-yl)piperidin-1-yl]-N-(quinoxalin-6-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 143237297 |
| Molecular Formula | C28H36N8 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 3-[2-(6-butan-2-yl-2-imidazol-1-ylpyrimidin-4-yl)piperidin-1-yl]-N-(quinoxalin-6-ylmethyl)propan-1-amine |
| SMILES | CCC(C)c1cc(C2CCCCN2CCCNCc2ccc3nccnc3c2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C28H36N8/c1-3-21(2)24-18-26(34-28(33-24)36-16-13-30-20-36)27-7-4-5-14-35(27)15-6-10-29-19-22-8-9-23-25(17-22)32-12-11-31-23/h8-9,11-13,16-18,20-21,27,29H,3-7,10,14-15,19H2,1-2H3 |
| InChIKey | OCPIDXAGWNDZRX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|