C19H24N6O2S — CID 143237320
N-[2-(7H-cyclohepta[d][1,3]dioxol-5-yl)ethyl]-N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 143237320) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is N-[2-(7H-cyclohepta[d][1,3]dioxol-5-yl)ethyl]-N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N-[2-(7H-cyclohepta[d][1,3]dioxol-5-yl)ethyl]-N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 143237320 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[2-(7H-cyclohepta[d][1,3]dioxol-5-yl)ethyl]-N'-(3-imidazol-1-yl-1,2,4-thiadiazol-5-yl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCC1=CCC=C2OCOC2=C1)CCN(C)c1nc(-n2ccnc2)ns1 |
| InChI | InChI=1S/C19H24N6O2S/c1-23(8-6-15-4-3-5-16-17(12-15)27-14-26-16)10-11-24(2)19-21-18(22-28-19)25-9-7-20-13-25/h4-5,7,9,12-13H,3,6,8,10-11,14H2,1-2H3 |
| InChIKey | GHSMJZHYNDMVFW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |