C17H18N2O — CID 143237409
2-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,3,4-oxadiazole (PubChem CID 143237409) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143237409 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(4-methylcyclohepta-1,3,5-trien-1-yl)-5-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-1,3,4-oxadiazole |
| SMILES | C=C(C)/C=C\C(=C)c1nnc(C2=CC=C(C)C=CC2)o1 |
| InChI | InChI=1S/C17H18N2O/c1-12(2)8-10-14(4)16-18-19-17(20-16)15-7-5-6-13(3)9-11-15/h5-6,8-11H,1,4,7H2,2-3H3/b10-8- |
| InChIKey | LKZPGEJXAMEJRT-NTMALXAHSA-N |
| XLogP | 4.50 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|