C31H29Cl3N2O2 — CID 143238032
1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-2-[2-[(1E,3Z,5Z)-hepta-1,3,5-trienoxy]phenyl]ethanone (PubChem CID 143238032) has the molecular formula C31H29Cl3N2O2 and a molecular weight of 567.94 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-2-[2-[(1E,3Z,5Z)-hepta-1,3,5-trienoxy]phenyl]ethanone.
| Compound Name | 1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-2-[2-[(1E,3Z,5Z)-hepta-1,3,5-trienoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 143238032 |
| Molecular Formula | C31H29Cl3N2O2 |
| Molecular Weight | 567.94 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-2-[2-[(1E,3Z,5Z)-hepta-1,3,5-trienoxy]phenyl]ethanone |
| SMILES | C/C=C\C=C/C=C/Oc1ccccc1CC(=O)N1CCN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C31H29Cl3N2O2/c1-2-3-4-5-8-19-38-30-10-7-6-9-24(30)20-31(37)35-17-18-36(28-16-15-26(33)21-27(28)34)29(22-35)23-11-13-25(32)14-12-23/h2-16,19,21,29H,17-18,20,22H2,1H3/b3-2-,5-4-,19-8+ |
| InChIKey | BIHWIZPGFVINRZ-OLJUOIBKSA-N |
| XLogP | 8.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.94 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|